380.250 PEOPLE
| People | Locations | Statistics |
|---|---|---|
| Tekkaya, A. Erman |
| |
| Förster, Peter |
| |
| Mudimu, George T. |
| |
| Shibata, Lillian Marie |
| |
| Talabbeydokhti, Nasser |
| |
| Laffite, Ernesto Dante Rodriguez |
| |
| Schöpke, Benito |
| |
| Gobis, Anna |
| |
| Alfares, Hesham K. |
| |
| Münzel, Thomas |
| |
| Joy, Gemini Velleringatt |
| |
| Oubahman, Laila |
| |
| Filali, Youssef |
| |
| Philippi, Paula |
| |
| George, Alinda |
| |
| Lucia, Caterina De |
| |
| Avril, Ludovic |
| |
| Belachew, Zigyalew Gashaw |
| |
| Kassens-Noor, Eva | Darmstadt |
|
| Cho, Seongchul |
| |
| Tonne, Cathryn |
| |
| Hosseinlou, Farhad |
| |
| Ganvit, Harsh |
| |
| Schmitt, Konrad Erich Kork |
| |
| Grimm, Daniel |
|
Levason, William
in Cooperation with on an Cooperation-Score of 37%
Topics
Publications (11/11 displayed)
- 2009Synthesis, characterisation and structures of thio-, seleno- and telluro-ether complexes of indium(III) halidescitations
- 2008Synthesis, characterisation and structures of thio-, seleno- and telluro-ether complexes of gallium(III)citations
- 2007Synthesis, spectroscopic and structural systematics of complexes of germanium(IV) halides (GeX4, X = F, Cl, Br or I) with phosphane oxides and related oxygen donor ligandscitations
- 2007Gallium(III) halide complexes with phosphines, arsines and phosphine oxides - a comparative studycitations
- 2006Synthesis and characterisation of tin(IV) fluoride complexes of phosphine and arsine oxide ligandscitations
- 2005Synthesis spectroscopic and structural properties of transition metal complexes of the o-xylyl diphosphine o-C6H4(CH2PPh2)2citations
- 2004Titanium, zirconium and hafnium halide complexes of trithioether and triselenoether ligandscitations
- 2002Arsenic(III) halide complexes with phosphine and arsine co-ligands: synthesis, spectroscopic and structural propertiescitations
- 2002Recent developments in thio-, seleno-, and telluro-ether ligand chemistrycitations
- 2002Scandium halide complexes of phosphine- and arsine-oxides: synthesis, structures and Sc-45 NMR studiescitations
- 2001Synthesis and structural studies on polymeric assemblies derived from antimony(III) halide complexes with bi- and tri-dentate and macrocyclic thio- and seleno-ether ligandscitations
Places of action
| Organizations | Location | People |
|---|