380.256 PEOPLE
| People | Locations | Statistics |
|---|---|---|
| Seuring, Stefan |
| |
| Nor Azizi, S. |
| |
| Pato, Margarida Vaz |
| |
| Kölker, Katrin |
| |
| Huber, Oliver |
| |
| Király, Tamás |
| |
| Spengler, Thomas Stefan |
| |
| Al-Ammar, Essam A. |
| |
| Dargahi, Fatemeh |
| |
| Mota, Rui |
| |
| Mazalan, Nurul Aliah Amirah |
| |
| Macharis, Cathy | Brussels |
|
| Arunasari, Yova Tri |
| |
| Nunez, Alfredo | Delft |
|
| Bouhorma, Mohammed |
| |
| Bonato, Matteo |
| |
| Fitriani, Ira |
| |
| Autor Correspondente Coelho, Sílvia. |
| |
| Pond, Stephen |
| |
| Okwara, Ukoha Kalu |
| |
| Toufigh, Vahid |
| |
| Campisi, Tiziana | Enna |
|
| Ermolieva, Tatiana |
| |
| Sánchez-Cambronero, Santos |
| |
| Agzamov, Akhror |
|
Reid, Gillian
University of Southampton
in Cooperation with on an Cooperation-Score of 37%
Topics
Publications (11/11 displayed)
- 2009Synthesis, characterisation and structures of thio-, seleno- and telluro-ether complexes of indium(III) halidescitations
- 2008Synthesis, characterisation and structures of thio-, seleno- and telluro-ether complexes of gallium(III)citations
- 2007Gallium(III) halide complexes with phosphines, arsines and phosphine oxides - a comparative studycitations
- 2007Synthesis, spectroscopic and structural systematics of complexes of germanium(IV) halides (GeX4, X = F, Cl, Br or I) with phosphane oxides and related oxygen donor ligandscitations
- 2006Synthesis and characterisation of tin(IV) fluoride complexes of phosphine and arsine oxide ligandscitations
- 2005Synthesis spectroscopic and structural properties of transition metal complexes of the o-xylyl diphosphine o-C6H4(CH2PPh2)2citations
- 2004Titanium, zirconium and hafnium halide complexes of trithioether and triselenoether ligandscitations
- 2002Recent developments in thio-, seleno-, and telluro-ether ligand chemistrycitations
- 2002Arsenic(III) halide complexes with phosphine and arsine co-ligands: synthesis, spectroscopic and structural propertiescitations
- 2002Scandium halide complexes of phosphine- and arsine-oxides: synthesis, structures and Sc-45 NMR studiescitations
- 2001Synthesis and structural studies on polymeric assemblies derived from antimony(III) halide complexes with bi- and tri-dentate and macrocyclic thio- and seleno-ether ligandscitations
Places of action
| Organizations | Location | People |
|---|